C21H31N3O5 — CID 142946530
tert-butyl (2R,4S)-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methyl]-4-methylpyrrolidine-1-carboxylate (PubChem CID 142946530) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methyl]-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methyl]-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142946530 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | tert-butyl (2R,4S)-2-[hydroxy-[4-(3-oxomorpholin-4-yl)anilino]methyl]-4-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@H](C(O)Nc2ccc(N3CCOCC3=O)cc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H31N3O5/c1-14-11-17(24(12-14)20(27)29-21(2,3)4)19(26)22-15-5-7-16(8-6-15)23-9-10-28-13-18(23)25/h5-8,14,17,19,22,26H,9-13H2,1-4H3/t14-,17+,19?/m0/s1 |
| InChIKey | MUINRTOFGVJYKR-WATMCTIVSA-N |
| XLogP | 2.43 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|