C25H40BrN3O4Si — CID 66809717
tert-butyl 2-[3-[acetyl-(3-bromo-2-pyridinyl)amino]prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 66809717) has the molecular formula C25H40BrN3O4Si and a molecular weight of 554.60 g/mol. Its IUPAC name is tert-butyl 2-[3-[acetyl-(3-bromo-2-pyridinyl)amino]prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[acetyl-(3-bromo-2-pyridinyl)amino]prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66809717 |
| Molecular Formula | C25H40BrN3O4Si |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | tert-butyl 2-[3-[acetyl-(3-bromo-2-pyridinyl)amino]prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)N(CC=CC1C(O[Si](C)(C)C(C)(C)C)CCN1C(=O)OC(C)(C)C)c1ncccc1Br |
| InChI | InChI=1S/C25H40BrN3O4Si/c1-18(30)28(22-19(26)12-10-15-27-22)16-11-13-20-21(33-34(8,9)25(5,6)7)14-17-29(20)23(31)32-24(2,3)4/h10-13,15,20-21H,14,16-17H2,1-9H3 |
| InChIKey | TXBLORFOAKCKJC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|