C26H40BrFN2O4Si — CID 66670120
tert-butyl (2R,3S)-2-[3-(N-acetyl-2-bromo-5-fluoroanilino)prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 66670120) has the molecular formula C26H40BrFN2O4Si and a molecular weight of 571.60 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-[3-(N-acetyl-2-bromo-5-fluoroanilino)prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-[3-(N-acetyl-2-bromo-5-fluoroanilino)prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66670120 |
| Molecular Formula | C26H40BrFN2O4Si |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | tert-butyl (2R,3S)-2-[3-(N-acetyl-2-bromo-5-fluoroanilino)prop-1-enyl]-3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)N(CC=C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OC(C)(C)C)c1cc(F)ccc1Br |
| InChI | InChI=1S/C26H40BrFN2O4Si/c1-18(31)29(22-17-19(28)12-13-20(22)27)15-10-11-21-23(34-35(8,9)26(5,6)7)14-16-30(21)24(32)33-25(2,3)4/h10-13,17,21,23H,14-16H2,1-9H3/t21-,23+/m1/s1 |
| InChIKey | CTNABBJDRSITOZ-GGAORHGYSA-N |
| XLogP | 6.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|