C18H26F2N2O5S — CID 167462949
[3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 167462949) has the molecular formula C18H26F2N2O5S and a molecular weight of 420.48 g/mol. Its IUPAC name is [3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167462949 |
| Molecular Formula | C18H26F2N2O5S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCN(NC(=O)OC(C)(C)C)CC2(F)F)cc1 |
| InChI | InChI=1S/C18H26F2N2O5S/c1-13-5-7-15(8-6-13)28(24,25)26-11-14-9-10-22(12-18(14,19)20)21-16(23)27-17(2,3)4/h5-8,14H,9-12H2,1-4H3,(H,21,23) |
| InChIKey | MUAFRZXVFRKPES-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|