C21H40N2O4Si — CID 145444317
tert-butyl (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(pyrrolidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 145444317) has the molecular formula C21H40N2O4Si and a molecular weight of 412.65 g/mol. Its IUPAC name is tert-butyl (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(pyrrolidine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(pyrrolidine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145444317 |
| Molecular Formula | C21H40N2O4Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | tert-butyl (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(pyrrolidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]1C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H40N2O4Si/c1-20(2,3)26-19(25)23-15-16(27-28(7,8)21(4,5)6)11-12-17(23)18(24)22-13-9-10-14-22/h16-17H,9-15H2,1-8H3/t16-,17-/m1/s1 |
| InChIKey | VRGMBDXQISTTSR-IAGOWNOFSA-N |
| XLogP | 4.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|