C16H26N2O5 — CID 118918517
1-O-tert-butyl 2-O-(piperidine-4-carbonyl) pyrrolidine-1,2-dicarboxylate (PubChem CID 118918517) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(piperidine-4-carbonyl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(piperidine-4-carbonyl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118918517 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-(piperidine-4-carbonyl) pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)OC(=O)C1CCNCC1 |
| InChI | InChI=1S/C16H26N2O5/c1-16(2,3)23-15(21)18-10-4-5-12(18)14(20)22-13(19)11-6-8-17-9-7-11/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | CGTLLBURGZOORZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|