C22H28N4O3 — CID 92604653
1-[(3S,3aR,7aR)-4-(3-ethylimidazole-4-carbonyl)-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]ethanone (PubChem CID 92604653) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-4-(3-ethylimidazole-4-carbonyl)-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]ethanone.
| Compound Name | 1-[(3S,3aR,7aR)-4-(3-ethylimidazole-4-carbonyl)-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 92604653 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[(3S,3aR,7aR)-4-(3-ethylimidazole-4-carbonyl)-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]ethanone |
| SMILES | CCn1cncc1C(=O)N1CCC[C@@H]2[C@H]1[C@@H](c1ccc(OC)cc1)CN2C(C)=O |
| InChI | InChI=1S/C22H28N4O3/c1-4-24-14-23-12-20(24)22(28)25-11-5-6-19-21(25)18(13-26(19)15(2)27)16-7-9-17(29-3)10-8-16/h7-10,12,14,18-19,21H,4-6,11,13H2,1-3H3/t18-,19-,21-/m1/s1 |
| InChIKey | PEFJSYKEEWVTHP-SFHLNBCPSA-N |
| XLogP | 2.53 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |