C16H20ClN3OS — CID 55738084
N-[(5-chlorothiophen-2-yl)methyl]-5-(2-methylpropyl)-N-prop-2-enyl-1H-pyrazole-3-carboxamide (PubChem CID 55738084) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-5-(2-methylpropyl)-N-prop-2-enyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-5-(2-methylpropyl)-N-prop-2-enyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55738084 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-5-(2-methylpropyl)-N-prop-2-enyl-1H-pyrazole-3-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1cc(CC(C)C)[nH]n1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-4-7-20(10-13-5-6-15(17)22-13)16(21)14-9-12(18-19-14)8-11(2)3/h4-6,9,11H,1,7-8,10H2,2-3H3,(H,18,19) |
| InChIKey | CEIXYUWMASTQAL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|