C14H23N3O — CID 61341996
1,1-diethyl-3-[4-[1-(methylamino)ethyl]phenyl]urea (PubChem CID 61341996) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1,1-diethyl-3-[4-[1-(methylamino)ethyl]phenyl]urea.
| Compound Name | 1,1-diethyl-3-[4-[1-(methylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 61341996 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1,1-diethyl-3-[4-[1-(methylamino)ethyl]phenyl]urea |
| SMILES | CCN(CC)C(=O)Nc1ccc(C(C)NC)cc1 |
| InChI | InChI=1S/C14H23N3O/c1-5-17(6-2)14(18)16-13-9-7-12(8-10-13)11(3)15-4/h7-11,15H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | KCFSKNRKCMENMG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |