C20H23F2N3O2 — CID 87001432
N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]-3,5-difluorobenzamide (PubChem CID 87001432) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]-3,5-difluorobenzamide.
| Compound Name | N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 87001432 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]-3,5-difluorobenzamide |
| SMILES | CCN(CC)C(=O)Nc1ccc(C(C)NC(=O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-4-25(5-2)20(27)24-18-8-6-14(7-9-18)13(3)23-19(26)15-10-16(21)12-17(22)11-15/h6-13H,4-5H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | LQXWKOMVZQROPG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |