C17H21N5O — CID 75416076
3-[4-[1-(2,2-dicyanoethenylamino)ethyl]phenyl]-1,1-diethylurea (PubChem CID 75416076) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-[4-[1-(2,2-dicyanoethenylamino)ethyl]phenyl]-1,1-diethylurea.
| Compound Name | 3-[4-[1-(2,2-dicyanoethenylamino)ethyl]phenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 75416076 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-[4-[1-(2,2-dicyanoethenylamino)ethyl]phenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(C(C)NC=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C17H21N5O/c1-4-22(5-2)17(23)21-16-8-6-15(7-9-16)13(3)20-12-14(10-18)11-19/h6-9,12-13,20H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | OJIFIGXKTBFEIK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|