C16H27ClN4O2 — CID 119295830
(2R)-2-amino-N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]propanamide;hydrochloride (PubChem CID 119295830) has the molecular formula C16H27ClN4O2 and a molecular weight of 342.87 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119295830 |
| Molecular Formula | C16H27ClN4O2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R)-2-amino-N-[1-[4-(diethylcarbamoylamino)phenyl]ethyl]propanamide;hydrochloride |
| SMILES | CCN(CC)C(=O)Nc1ccc(C(C)NC(=O)[C@@H](C)N)cc1.Cl |
| InChI | InChI=1S/C16H26N4O2.ClH/c1-5-20(6-2)16(22)19-14-9-7-13(8-10-14)12(4)18-15(21)11(3)17;/h7-12H,5-6,17H2,1-4H3,(H,18,21)(H,19,22);1H/t11-,12?;/m1./s1 |
| InChIKey | ROCTWAADLROYOS-BAVFUAOSSA-N |
| XLogP | 2.51 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |