C13H21N3O3 — CID 61341512
3-[4-(1-aminoethyl)phenyl]-1,1-bis(2-hydroxyethyl)urea (PubChem CID 61341512) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[4-(1-aminoethyl)phenyl]-1,1-bis(2-hydroxyethyl)urea.
| Compound Name | 3-[4-(1-aminoethyl)phenyl]-1,1-bis(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 61341512 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[4-(1-aminoethyl)phenyl]-1,1-bis(2-hydroxyethyl)urea |
| SMILES | CC(N)c1ccc(NC(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C13H21N3O3/c1-10(14)11-2-4-12(5-3-11)15-13(19)16(6-8-17)7-9-18/h2-5,10,17-18H,6-9,14H2,1H3,(H,15,19) |
| InChIKey | YOKCFQMGHDYEFT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |