C16H20N4O — CID 61342243
3-[4-(1-aminoethyl)phenyl]-1-methyl-1-(pyridin-4-ylmethyl)urea (PubChem CID 61342243) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[4-(1-aminoethyl)phenyl]-1-methyl-1-(pyridin-4-ylmethyl)urea.
| Compound Name | 3-[4-(1-aminoethyl)phenyl]-1-methyl-1-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 61342243 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-[4-(1-aminoethyl)phenyl]-1-methyl-1-(pyridin-4-ylmethyl)urea |
| SMILES | CC(N)c1ccc(NC(=O)N(C)Cc2ccncc2)cc1 |
| InChI | InChI=1S/C16H20N4O/c1-12(17)14-3-5-15(6-4-14)19-16(21)20(2)11-13-7-9-18-10-8-13/h3-10,12H,11,17H2,1-2H3,(H,19,21) |
| InChIKey | PZNHTSDOTOAJAD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |