C18H22N2O7S — CID 3759124
N-(3,5-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)sulfamoyl]acetamide (PubChem CID 3759124) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)sulfamoyl]acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 3759124 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)sulfamoyl]acetamide |
| SMILES | COc1cc(NC(=O)CS(=O)(=O)Nc2cc(OC)cc(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H22N2O7S/c1-24-14-5-12(6-15(9-14)25-2)19-18(21)11-28(22,23)20-13-7-16(26-3)10-17(8-13)27-4/h5-10,20H,11H2,1-4H3,(H,19,21) |
| InChIKey | NBIKVDPBXLAJIY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |