C10H6F6O2 — CID 114032797
1-(2,6-difluoro-4-methoxyphenyl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 114032797) has the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-methoxyphenyl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(2,6-difluoro-4-methoxyphenyl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 114032797 |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 1-(2,6-difluoro-4-methoxyphenyl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | COc1cc(F)c(C(=O)C(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C10H6F6O2/c1-18-4-2-5(11)7(6(12)3-4)8(17)10(15,16)9(13)14/h2-3,9H,1H3 |
| InChIKey | OQLISKKPDVAXLX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|