C15H12F2O2 — CID 54880508
(2,6-difluoro-4-methoxyphenyl)-(4-methylphenyl)methanone (PubChem CID 54880508) has the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. Its IUPAC name is (2,6-difluoro-4-methoxyphenyl)-(4-methylphenyl)methanone.
| Compound Name | (2,6-difluoro-4-methoxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 54880508 |
| Molecular Formula | C15H12F2O2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (2,6-difluoro-4-methoxyphenyl)-(4-methylphenyl)methanone |
| SMILES | COc1cc(F)c(C(=O)c2ccc(C)cc2)c(F)c1 |
| InChI | InChI=1S/C15H12F2O2/c1-9-3-5-10(6-4-9)15(18)14-12(16)7-11(19-2)8-13(14)17/h3-8H,1-2H3 |
| InChIKey | AKLXKQMFVUXBTK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |