C14H8Cl2F2O2 — CID 60965946
(3,5-dichlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanone (PubChem CID 60965946) has the molecular formula C14H8Cl2F2O2 and a molecular weight of 317.12 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanone.
| Compound Name | (3,5-dichlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 60965946 |
| Molecular Formula | C14H8Cl2F2O2 |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (3,5-dichlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanone |
| SMILES | COc1cc(F)c(C(=O)c2cc(Cl)cc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C14H8Cl2F2O2/c1-20-10-5-11(17)13(12(18)6-10)14(19)7-2-8(15)4-9(16)3-7/h2-6H,1H3 |
| InChIKey | SIMFRLXINYZXDT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |