C13H18ClNO3 — CID 2764507
3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide (PubChem CID 2764507) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2764507 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide |
| SMILES | COc1cc(NC(=O)C(C)(C)CCl)cc(OC)c1 |
| InChI | InChI=1S/C13H18ClNO3/c1-13(2,8-14)12(16)15-9-5-10(17-3)7-11(6-9)18-4/h5-7H,8H2,1-4H3,(H,15,16) |
| InChIKey | DUSLEHJSBPZZFH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|