C14H21NO5 — CID 13304013
propan-2-yl N-(4-ethoxy-3,5-dimethoxyphenyl)carbamate (PubChem CID 13304013) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is propan-2-yl N-(4-ethoxy-3,5-dimethoxyphenyl)carbamate.
| Compound Name | propan-2-yl N-(4-ethoxy-3,5-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 13304013 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | propan-2-yl N-(4-ethoxy-3,5-dimethoxyphenyl)carbamate |
| SMILES | CCOc1c(OC)cc(NC(=O)OC(C)C)cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-6-19-13-11(17-4)7-10(8-12(13)18-5)15-14(16)20-9(2)3/h7-9H,6H2,1-5H3,(H,15,16) |
| InChIKey | HZEQXYGVHLQBFS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |