C12H19NO3 — CID 23620608
4-ethoxy-N-ethyl-3,5-dimethoxyaniline (PubChem CID 23620608) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-3,5-dimethoxyaniline.
| Compound Name | 4-ethoxy-N-ethyl-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 23620608 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 4-ethoxy-N-ethyl-3,5-dimethoxyaniline |
| SMILES | CCNc1cc(OC)c(OCC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO3/c1-5-13-9-7-10(14-3)12(16-6-2)11(8-9)15-4/h7-8,13H,5-6H2,1-4H3 |
| InChIKey | WIZRILFBRUOAMZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|