C10H14FNO2 — CID 10943484
N-ethyl-4-fluoro-3,5-dimethoxyaniline (PubChem CID 10943484) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is N-ethyl-4-fluoro-3,5-dimethoxyaniline.
| Compound Name | N-ethyl-4-fluoro-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 10943484 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-ethyl-4-fluoro-3,5-dimethoxyaniline |
| SMILES | CCNc1cc(OC)c(F)c(OC)c1 |
| InChI | InChI=1S/C10H14FNO2/c1-4-12-7-5-8(13-2)10(11)9(6-7)14-3/h5-6,12H,4H2,1-3H3 |
| InChIKey | BPUIFOJPCYMULM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |