C15H23NO4 — CID 13304051
propan-2-yl N-[4-ethoxy-3-(methoxymethyl)-5-methylphenyl]carbamate (PubChem CID 13304051) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is propan-2-yl N-[4-ethoxy-3-(methoxymethyl)-5-methylphenyl]carbamate.
| Compound Name | propan-2-yl N-[4-ethoxy-3-(methoxymethyl)-5-methylphenyl]carbamate |
|---|---|
| PubChem CID | 13304051 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | propan-2-yl N-[4-ethoxy-3-(methoxymethyl)-5-methylphenyl]carbamate |
| SMILES | CCOc1c(C)cc(NC(=O)OC(C)C)cc1COC |
| InChI | InChI=1S/C15H23NO4/c1-6-19-14-11(4)7-13(8-12(14)9-18-5)16-15(17)20-10(2)3/h7-8,10H,6,9H2,1-5H3,(H,16,17) |
| InChIKey | MDSRTWKNMSHEPN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |