C14H20FNO4 — CID 13454493
propan-2-yl N-(3,4-diethoxy-2-fluorophenyl)carbamate (PubChem CID 13454493) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is propan-2-yl N-(3,4-diethoxy-2-fluorophenyl)carbamate.
| Compound Name | propan-2-yl N-(3,4-diethoxy-2-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 13454493 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | propan-2-yl N-(3,4-diethoxy-2-fluorophenyl)carbamate |
| SMILES | CCOc1ccc(NC(=O)OC(C)C)c(F)c1OCC |
| InChI | InChI=1S/C14H20FNO4/c1-5-18-11-8-7-10(12(15)13(11)19-6-2)16-14(17)20-9(3)4/h7-9H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | JHAVSNZRXQHREV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |