C11H12BrNO5S — CID 14581769
2-acetamido-3-(3-bromo-2,5-dihydroxyphenyl)sulfanylpropanoic acid (PubChem CID 14581769) has the molecular formula C11H12BrNO5S and a molecular weight of 350.19 g/mol. Its IUPAC name is 2-acetamido-3-(3-bromo-2,5-dihydroxyphenyl)sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-(3-bromo-2,5-dihydroxyphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 14581769 |
| Molecular Formula | C11H12BrNO5S |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 2-acetamido-3-(3-bromo-2,5-dihydroxyphenyl)sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSc1cc(O)cc(Br)c1O)C(=O)O |
| InChI | InChI=1S/C11H12BrNO5S/c1-5(14)13-8(11(17)18)4-19-9-3-6(15)2-7(12)10(9)16/h2-3,8,15-16H,4H2,1H3,(H,13,14)(H,17,18) |
| InChIKey | NWHGRDNQEXMEMK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|