C13H15N2NaO5S — CID 4248189
sodium 2-acetamido-3-(5-acetamido-2-hydroxyphenyl)sulfanylpropanoate (PubChem CID 4248189) has the molecular formula C13H15N2NaO5S and a molecular weight of 334.33 g/mol. Its IUPAC name is sodium 2-acetamido-3-(5-acetamido-2-hydroxyphenyl)sulfanylpropanoate.
| Compound Name | sodium 2-acetamido-3-(5-acetamido-2-hydroxyphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 4248189 |
| Molecular Formula | C13H15N2NaO5S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | sodium 2-acetamido-3-(5-acetamido-2-hydroxyphenyl)sulfanylpropanoate |
| SMILES | CC(=O)Nc1ccc(O)c(SCC(NC(C)=O)C(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C13H16N2O5S.Na/c1-7(16)14-9-3-4-11(18)12(5-9)21-6-10(13(19)20)15-8(2)17;/h3-5,10,18H,6H2,1-2H3,(H,14,16)(H,15,17)(H,19,20);/q;+1/p-1 |
| InChIKey | JKIDIVFUGFKUBH-UHFFFAOYSA-M |
| XLogP | -3.30 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|