C13H15N2NaO5S — CID 131667746
sodium N-[3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2,6-dideuterio-4-hydroxyphenyl]-2,2,2-trideuterioethanimidate (PubChem CID 131667746) has the molecular formula C13H15N2NaO5S and a molecular weight of 339.36 g/mol. Its IUPAC name is sodium N-[3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2,6-dideuterio-4-hydroxyphenyl]-2,2,2-trideuterioethanimidate.
| Compound Name | sodium N-[3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2,6-dideuterio-4-hydroxyphenyl]-2,2,2-trideuterioethanimidate |
|---|---|
| PubChem CID | 131667746 |
| Molecular Formula | C13H15N2NaO5S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | sodium N-[3-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2,6-dideuterio-4-hydroxyphenyl]-2,2,2-trideuterioethanimidate |
| SMILES | [2H]c1cc(O)c(SC[C@H](NC(C)=O)C(=O)O)c([2H])c1/N=C(\[O-])C([2H])([2H])[2H].[Na+] |
| InChI | InChI=1S/C13H16N2O5S.Na/c1-7(16)14-9-3-4-11(18)12(5-9)21-6-10(13(19)20)15-8(2)17;/h3-5,10,18H,6H2,1-2H3,(H,14,16)(H,15,17)(H,19,20);/q;+1/p-1/t10-;/m0./s1/i1D3,3D,5D; |
| InChIKey | JKIDIVFUGFKUBH-SWHSFZNRSA-M |
| XLogP | -2.51 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|