C11H11Cl3N2O5S — CID 163124215
2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4,5-trichloro-N-hydroxybenzeneamine oxide (PubChem CID 163124215) has the molecular formula C11H11Cl3N2O5S and a molecular weight of 389.64 g/mol. Its IUPAC name is 2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4,5-trichloro-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4,5-trichloro-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163124215 |
| Molecular Formula | C11H11Cl3N2O5S |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4,5-trichloro-N-hydroxybenzeneamine oxide |
| SMILES | CC(=O)N[C@@H](CSc1c([NH+]([O-])O)cc(Cl)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C11H11Cl3N2O5S/c1-4(17)15-6(11(18)19)3-22-10-7(16(20)21)2-5(12)8(13)9(10)14/h2,6,16,20H,3H2,1H3,(H,15,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | CQGKQCRKPKLWMH-LURJTMIESA-N |
| XLogP | 1.73 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|