C14H18Cl2N2O3 — CID 107146519
(2S)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]hexanoic acid (PubChem CID 107146519) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107146519 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2S)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)Nc1cc(Cl)c(C)cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-3-4-5-11(13(19)20)17-14(21)18-12-7-9(15)8(2)6-10(12)16/h6-7,11H,3-5H2,1-2H3,(H,19,20)(H2,17,18,21)/t11-/m0/s1 |
| InChIKey | FJXAFBHQZLCXOL-NSHDSACASA-N |
| XLogP | 4.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |