C13H17ClN2O5 — CID 81085869
2-[(4-chloro-2-methoxy-5-methylphenyl)carbamoylamino]-3-methoxypropanoic acid (PubChem CID 81085869) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 2-[(4-chloro-2-methoxy-5-methylphenyl)carbamoylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[(4-chloro-2-methoxy-5-methylphenyl)carbamoylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81085869 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[(4-chloro-2-methoxy-5-methylphenyl)carbamoylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)Nc1cc(C)c(Cl)cc1OC)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O5/c1-7-4-9(11(21-3)5-8(7)14)15-13(19)16-10(6-20-2)12(17)18/h4-5,10H,6H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | RIJDKOOVRSVKLR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |