C13H15Cl2NOS — CID 107034934
N-(2,5-dichloro-4-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107034934) has the molecular formula C13H15Cl2NOS and a molecular weight of 304.24 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107034934 |
| Molecular Formula | C13H15Cl2NOS |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | Cc1cc(Cl)c(NC(=O)CC2(CS)CC2)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NOS/c1-8-4-10(15)11(5-9(8)14)16-12(17)6-13(7-18)2-3-13/h4-5,18H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | GPMKIKFCFCXMTJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|