C13H15BrFNOS — CID 107036112
N-(4-bromo-5-fluoro-2-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107036112) has the molecular formula C13H15BrFNOS and a molecular weight of 332.24 g/mol. Its IUPAC name is N-(4-bromo-5-fluoro-2-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-(4-bromo-5-fluoro-2-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107036112 |
| Molecular Formula | C13H15BrFNOS |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N-(4-bromo-5-fluoro-2-methylphenyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | Cc1cc(Br)c(F)cc1NC(=O)CC1(CS)CC1 |
| InChI | InChI=1S/C13H15BrFNOS/c1-8-4-9(14)10(15)5-11(8)16-12(17)6-13(7-18)2-3-13/h4-5,18H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | PAYAIIIEIDOLGZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|