C8H9ClFN — CID 131225434
5-chloro-2-fluoro-N,4-dimethylaniline (PubChem CID 131225434) has the molecular formula C8H9ClFN and a molecular weight of 173.62 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N,4-dimethylaniline.
| Compound Name | 5-chloro-2-fluoro-N,4-dimethylaniline |
|---|---|
| PubChem CID | 131225434 |
| Molecular Formula | C8H9ClFN |
| Molecular Weight | 173.62 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 5-chloro-2-fluoro-N,4-dimethylaniline |
| SMILES | CNc1cc(Cl)c(C)cc1F |
| InChI | InChI=1S/C8H9ClFN/c1-5-3-7(10)8(11-2)4-6(5)9/h3-4,11H,1-2H3 |
| InChIKey | PIJUXTJSFYCCPG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |