About 5-cyclopropyl-2-fluoro-N,4-dimethylaniline
5-cyclopropyl-2-fluoro-N,4-dimethylaniline (PubChem CID 166728321) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-cyclopropyl-2-fluoro-N,4-dimethylaniline.
Molecular Properties
| Compound Name | 5-cyclopropyl-2-fluoro-N,4-dimethylaniline |
| PubChem CID | 166728321 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-cyclopropyl-2-fluoro-N,4-dimethylaniline |
| SMILES | CNc1cc(C2CC2)c(C)cc1F |
| InChI | InChI=1S/C11H14FN/c1-7-5-10(12)11(13-2)6-9(7)8-3-4-8/h5-6,8,13H,3-4H2,1-2H3 |
| InChIKey | VZAWZRXXUPZNPA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclopropyl-2-fluoro-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2-fluoro-N,4-dimethylaniline?
The IUPAC name of 5-cyclopropyl-2-fluoro-N,4-dimethylaniline (CID 166728321) is 5-cyclopropyl-2-fluoro-N,4-dimethylaniline.
What is the SMILES notation for 5-cyclopropyl-2-fluoro-N,4-dimethylaniline?
The canonical SMILES for 5-cyclopropyl-2-fluoro-N,4-dimethylaniline is CNc1cc(C2CC2)c(C)cc1F.
What is the InChIKey of 5-cyclopropyl-2-fluoro-N,4-dimethylaniline?
The InChIKey is VZAWZRXXUPZNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-7-5-10(12)11(13-2)6-9(7)8-3-4-8/h5-6,8,13H,3-4H2,1-2H3.
What are the key properties of 5-cyclopropyl-2-fluoro-N,4-dimethylaniline?
5-cyclopropyl-2-fluoro-N,4-dimethylaniline has a molecular weight of 179.24 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2-fluoro-N,4-dimethylaniline is sourced from PubChem (CID 166728321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).