C10H11F2N — CID 177162139
4-cyclopropyl-2,6-difluoro-N-methylaniline (PubChem CID 177162139) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 4-cyclopropyl-2,6-difluoro-N-methylaniline.
| Compound Name | 4-cyclopropyl-2,6-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 177162139 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 4-cyclopropyl-2,6-difluoro-N-methylaniline |
| SMILES | CNc1c(F)cc(C2CC2)cc1F |
| InChI | InChI=1S/C10H11F2N/c1-13-10-8(11)4-7(5-9(10)12)6-2-3-6/h4-6,13H,2-3H2,1H3 |
| InChIKey | PMOOSINQDSJPDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |