C10H8F2O — CID 163302596
4-cyclopropyl-2,6-difluorobenzaldehyde (PubChem CID 163302596) has the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-cyclopropyl-2,6-difluorobenzaldehyde.
| Compound Name | 4-cyclopropyl-2,6-difluorobenzaldehyde |
|---|---|
| PubChem CID | 163302596 |
| Molecular Formula | C10H8F2O |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-cyclopropyl-2,6-difluorobenzaldehyde |
| SMILES | O=Cc1c(F)cc(C2CC2)cc1F |
| InChI | InChI=1S/C10H8F2O/c11-9-3-7(6-1-2-6)4-10(12)8(9)5-13/h3-6H,1-2H2 |
| InChIKey | XDQDTCZVCSZIAY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|