C12H3Cl7O — CID 14935807
1,2,3,4-tetrachloro-5-(2,3,6-trichlorophenoxy)benzene (PubChem CID 14935807) has the molecular formula C12H3Cl7O and a molecular weight of 411.33 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-5-(2,3,6-trichlorophenoxy)benzene.
| Compound Name | 1,2,3,4-tetrachloro-5-(2,3,6-trichlorophenoxy)benzene |
|---|---|
| PubChem CID | 14935807 |
| Molecular Formula | C12H3Cl7O |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 407.80 |
| IUPAC Name | 1,2,3,4-tetrachloro-5-(2,3,6-trichlorophenoxy)benzene |
| SMILES | Clc1cc(Oc2c(Cl)ccc(Cl)c2Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H3Cl7O/c13-4-1-2-5(14)12(9(4)17)20-7-3-6(15)8(16)11(19)10(7)18/h1-3H |
| InChIKey | DQYYZAABYZAOOC-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|