C28H34Cl2N2O9 — CID 159489396
ethyl (E)-3-(2-acetamido-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate;ethyl (E)-3-(2-amino-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 159489396) has the molecular formula C28H34Cl2N2O9 and a molecular weight of 613.49 g/mol. Its IUPAC name is ethyl (E)-3-(2-acetamido-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate;ethyl (E)-3-(2-amino-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2-acetamido-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate;ethyl (E)-3-(2-amino-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 159489396 |
| Molecular Formula | C28H34Cl2N2O9 |
| Molecular Weight | 613.49 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | ethyl (E)-3-(2-acetamido-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate;ethyl (E)-3-(2-amino-4-chloro-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(OC)c(Cl)c(OC)c1N.CCOC(=O)/C=C/c1cc(OC)c(Cl)c(OC)c1NC(C)=O |
| InChI | InChI=1S/C15H18ClNO5.C13H16ClNO4/c1-5-22-12(19)7-6-10-8-11(20-3)13(16)15(21-4)14(10)17-9(2)18;1-4-19-10(16)6-5-8-7-9(17-2)11(14)13(18-3)12(8)15/h6-8H,5H2,1-4H3,(H,17,18);5-7H,4,15H2,1-3H3/b7-6+;6-5+ |
| InChIKey | LXZMCHUMJSHWEK-MAVWREHFSA-N |
| XLogP | 5.41 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|