C17H20N2O4 — CID 142261856
ethyl (Z)-3-[1-(aminomethyl)-6,7-dimethoxyisoquinolin-4-yl]prop-2-enoate (PubChem CID 142261856) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl (Z)-3-[1-(aminomethyl)-6,7-dimethoxyisoquinolin-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[1-(aminomethyl)-6,7-dimethoxyisoquinolin-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 142261856 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethyl (Z)-3-[1-(aminomethyl)-6,7-dimethoxyisoquinolin-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\c1cnc(CN)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C17H20N2O4/c1-4-23-17(20)6-5-11-10-19-14(9-18)13-8-16(22-3)15(21-2)7-12(11)13/h5-8,10H,4,9,18H2,1-3H3/b6-5- |
| InChIKey | LQUCJPJSFQUUHE-WAYWQWQTSA-N |
| XLogP | 2.29 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|