C16H20N2O5 — CID 12043868
ethyl 1-(aminomethyl)-5,6,7-trimethoxyisoquinoline-4-carboxylate (PubChem CID 12043868) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 1-(aminomethyl)-5,6,7-trimethoxyisoquinoline-4-carboxylate.
| Compound Name | ethyl 1-(aminomethyl)-5,6,7-trimethoxyisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 12043868 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 1-(aminomethyl)-5,6,7-trimethoxyisoquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1cnc(CN)c2cc(OC)c(OC)c(OC)c12 |
| InChI | InChI=1S/C16H20N2O5/c1-5-23-16(19)10-8-18-11(7-17)9-6-12(20-2)14(21-3)15(22-4)13(9)10/h6,8H,5,7,17H2,1-4H3 |
| InChIKey | KYIYYSNDEIDYOF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |