C15H17ClO5 — CID 12007663
ethyl (E)-3-[5-(2-chloroacetyl)-2,4-dimethoxyphenyl]prop-2-enoate (PubChem CID 12007663) has the molecular formula C15H17ClO5 and a molecular weight of 312.75 g/mol. Its IUPAC name is ethyl (E)-3-[5-(2-chloroacetyl)-2,4-dimethoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-(2-chloroacetyl)-2,4-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 12007663 |
| Molecular Formula | C15H17ClO5 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | ethyl (E)-3-[5-(2-chloroacetyl)-2,4-dimethoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(C(=O)CCl)c(OC)cc1OC |
| InChI | InChI=1S/C15H17ClO5/c1-4-21-15(18)6-5-10-7-11(12(17)9-16)14(20-3)8-13(10)19-2/h5-8H,4,9H2,1-3H3/b6-5+ |
| InChIKey | NAHUORKSPKJORJ-AATRIKPKSA-N |
| XLogP | 2.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|