C10H12F2N2O3 — CID 175200218
1-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methylurea (PubChem CID 175200218) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is 1-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methylurea.
| Compound Name | 1-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methylurea |
|---|---|
| PubChem CID | 175200218 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(2,6-difluoro-3,5-dimethoxyphenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1c(F)c(OC)cc(OC)c1F |
| InChI | InChI=1S/C10H12F2N2O3/c1-13-10(15)14-9-7(11)5(16-2)4-6(17-3)8(9)12/h4H,1-3H3,(H2,13,14,15) |
| InChIKey | TURAXUAVIRYUPV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |