C19H18BrFN2O4 — CID 141437051
(E)-3-(2-bromo-3,4,5-trimethoxyphenyl)-N-[(E)-(2-fluorophenyl)methylideneamino]prop-2-enamide (PubChem CID 141437051) has the molecular formula C19H18BrFN2O4 and a molecular weight of 437.27 g/mol. Its IUPAC name is (E)-3-(2-bromo-3,4,5-trimethoxyphenyl)-N-[(E)-(2-fluorophenyl)methylideneamino]prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-3,4,5-trimethoxyphenyl)-N-[(E)-(2-fluorophenyl)methylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 141437051 |
| Molecular Formula | C19H18BrFN2O4 |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (E)-3-(2-bromo-3,4,5-trimethoxyphenyl)-N-[(E)-(2-fluorophenyl)methylideneamino]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N/N=C/c2ccccc2F)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C19H18BrFN2O4/c1-25-15-10-12(17(20)19(27-3)18(15)26-2)8-9-16(24)23-22-11-13-6-4-5-7-14(13)21/h4-11H,1-3H3,(H,23,24)/b9-8+,22-11+ |
| InChIKey | OCOKOOIDEJOEQF-PREBZYBQSA-N |
| XLogP | 3.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|