About 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol
2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol (PubChem CID 159426539) has the molecular formula C11H15F3S
and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol |
| PubChem CID | 159426539 |
| Molecular Formula | C11H15F3S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol |
| SMILES | CCCS.Cc1ccc(F)c(C(F)F)c1 |
| InChI | InChI=1S/C8H7F3.C3H8S/c1-5-2-3-7(9)6(4-5)8(10)11;1-2-3-4/h2-4,8H,1H3;4H,2-3H2,1H3 |
| InChIKey | LQKTUZSXKCBFSS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol?
The IUPAC name of 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol (CID 159426539) is 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol.
What is the SMILES notation for 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol?
The canonical SMILES for 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol is CCCS.Cc1ccc(F)c(C(F)F)c1.
What is the InChIKey of 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol?
The InChIKey is LQKTUZSXKCBFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3.C3H8S/c1-5-2-3-7(9)6(4-5)8(10)11;1-2-3-4/h2-4,8H,1H3;4H,2-3H2,1H3.
What are the key properties of 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol?
2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol has a molecular weight of 236.30 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1-fluoro-4-methylbenzene;propane-1-thiol is sourced from PubChem (CID 159426539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).