C9H12FNO2 — CID 55270468
4-[(1R,2S)-1-amino-2-hydroxypropyl]-3-fluorophenol (PubChem CID 55270468) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxypropyl]-3-fluorophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]-3-fluorophenol |
|---|---|
| PubChem CID | 55270468 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]-3-fluorophenol |
| SMILES | C[C@H](O)[C@H](N)c1ccc(O)cc1F |
| InChI | InChI=1S/C9H12FNO2/c1-5(12)9(11)7-3-2-6(13)4-8(7)10/h2-5,9,12-13H,11H2,1H3/t5-,9-/m0/s1 |
| InChIKey | GSUPQKXDKROARR-CDUCUWFYSA-N |
| XLogP | 0.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |