C13H20N4O2S — CID 66190132
ethyl 2-(3-azidopropylamino)-2-(2,5-dimethylthiophen-3-yl)acetate (PubChem CID 66190132) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is ethyl 2-(3-azidopropylamino)-2-(2,5-dimethylthiophen-3-yl)acetate.
| Compound Name | ethyl 2-(3-azidopropylamino)-2-(2,5-dimethylthiophen-3-yl)acetate |
|---|---|
| PubChem CID | 66190132 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl 2-(3-azidopropylamino)-2-(2,5-dimethylthiophen-3-yl)acetate |
| SMILES | CCOC(=O)C(NCCCN=[N+]=[N-])c1cc(C)sc1C |
| InChI | InChI=1S/C13H20N4O2S/c1-4-19-13(18)12(15-6-5-7-16-17-14)11-8-9(2)20-10(11)3/h8,12,15H,4-7H2,1-3H3 |
| InChIKey | BIYQKSUTFOUETP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|