C12H14Cl2N4O2 — CID 66190048
ethyl 2-(2-azidoethylamino)-2-(2,3-dichlorophenyl)acetate (PubChem CID 66190048) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is ethyl 2-(2-azidoethylamino)-2-(2,3-dichlorophenyl)acetate.
| Compound Name | ethyl 2-(2-azidoethylamino)-2-(2,3-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 66190048 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | ethyl 2-(2-azidoethylamino)-2-(2,3-dichlorophenyl)acetate |
| SMILES | CCOC(=O)C(NCCN=[N+]=[N-])c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N4O2/c1-2-20-12(19)11(16-6-7-17-18-15)8-4-3-5-9(13)10(8)14/h3-5,11,16H,2,6-7H2,1H3 |
| InChIKey | ABMMBMMPCRXWTE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|