C16H19NO2S — CID 62217801
4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzoic acid (PubChem CID 62217801) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzoic acid.
| Compound Name | 4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 62217801 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]benzoic acid |
| SMILES | Cc1cc(C(C)NCc2ccc(C(=O)O)cc2)c(C)s1 |
| InChI | InChI=1S/C16H19NO2S/c1-10-8-15(12(3)20-10)11(2)17-9-13-4-6-14(7-5-13)16(18)19/h4-8,11,17H,9H2,1-3H3,(H,18,19) |
| InChIKey | QSGDSUPVKYCCGH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |