C15H16BrNO2S — CID 82801714
3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzoic acid (PubChem CID 82801714) has the molecular formula C15H16BrNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzoic acid.
| Compound Name | 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 82801714 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzoic acid |
| SMILES | Cc1cc(C(C)Nc2ccc(C(=O)O)cc2Br)c(C)s1 |
| InChI | InChI=1S/C15H16BrNO2S/c1-8-6-12(10(3)20-8)9(2)17-14-5-4-11(15(18)19)7-13(14)16/h4-7,9,17H,1-3H3,(H,18,19) |
| InChIKey | FERBHHMBIJUUAT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |