C14H14BrCl2NS — CID 107787895
4-bromo-2,3-dichloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]aniline (PubChem CID 107787895) has the molecular formula C14H14BrCl2NS and a molecular weight of 379.15 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107787895 |
| Molecular Formula | C14H14BrCl2NS |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]aniline |
| SMILES | Cc1cc(C(C)Nc2ccc(Br)c(Cl)c2Cl)c(C)s1 |
| InChI | InChI=1S/C14H14BrCl2NS/c1-7-6-10(9(3)19-7)8(2)18-12-5-4-11(15)13(16)14(12)17/h4-6,8,18H,1-3H3 |
| InChIKey | AHKULXHVOMEJOB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|